Difference between revisions of "3-Ketoglutaryl-ACP-methyl-ester"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] == * smiles: ** C1(C(=CC(=C(C=1)O)CC([O-])=O)O) * inchi key: ** In...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketoglutaryl-ACP-methyl-ester 3-Ketoglutaryl-ACP-methyl-ester] == * common name: ** a 3-oxo-g...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketoglutaryl-ACP-methyl-ester 3-Ketoglutaryl-ACP-methyl-ester] ==
−
* smiles:
+
−
** C1(C(=CC(=C(C=1)O)CC([O-])=O)O)
+
−
* inchi key:
+
−
** InChIKey=IGMNYECMUMZDDF-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** homogentisate
+
** a 3-oxo-glutaryl-[acp] methyl ester
−
* molecular weight:
+
−
** 167.141   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2,5-dihydroxyphenylacetate
+
** a 3-ketoglutaryl-[acp] methyl ester
 +
** a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[HGDO]]
+
* [[RXN-11476]]
−
* [[HOMOGENTISATE-12-DIOXYGENASE-RXN]]
+
−
* [[RXN-2541]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[HPPD]]
+
* [[RXN-11474]]
−
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 3-oxo-glutaryl-[acp] methyl ester}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460389 5460389]
+
{{#set: common name=a 3-ketoglutaryl-[acp] methyl ester|a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester}}
−
* HMDB : HMDB00130
+
{{#set: consumed by=RXN-11476}}
−
* LIGAND-CPD:
+
{{#set: produced by=RXN-11474}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00544 C00544]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573931.html 4573931]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16169 16169]
+
−
* METABOLIGHTS : MTBLC16169
+
−
{{#set: smiles=C1(C(=CC(=C(C=1)O)CC([O-])=O)O)}}
+
−
{{#set: inchi key=InChIKey=IGMNYECMUMZDDF-UHFFFAOYSA-M}}
+
−
{{#set: common name=homogentisate}}
+
−
{{#set: molecular weight=167.141    }}
+
−
{{#set: common name=2,5-dihydroxyphenylacetate}}
+
−
{{#set: consumed by=HGDO|HOMOGENTISATE-12-DIOXYGENASE-RXN|RXN-2541}}
+
−
{{#set: produced by=HPPD|4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN}}
+

Latest revision as of 20:14, 21 March 2018

Metabolite 3-Ketoglutaryl-ACP-methyl-ester

  • common name:
    • a 3-oxo-glutaryl-[acp] methyl ester
  • Synonym(s):
    • a 3-ketoglutaryl-[acp] methyl ester
    • a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-glutaryl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-ketoglutaryl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-Ketoglutaryl-ACP-methyl-ester&oldid=47130"