Difference between revisions of "CPD-7078"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Adjacent-Pyrimidines DNA-Adjacent-Pyrimidines] == * Synonym(s): ** 2 pyrimidine residues (i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == * smiles: ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == |
| + | * smiles: | ||
| + | ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O | ||
| + | * common name: | ||
| + | ** GDP-β-L-gulose | ||
| + | * inchi key: | ||
| + | ** InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L | ||
| + | * molecular weight: | ||
| + | ** 603.329 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-7772]] | ||
| + | * [[RXN-7771]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657274 90657274] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15925 C15925] | ||
| + | {{#set: smiles=C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O}} | ||
| + | {{#set: common name=GDP-β-L-gulose}} | ||
| + | {{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L}} | ||
| + | {{#set: molecular weight=603.329 }} | ||
| + | {{#set: reversible reaction associated=RXN-7772|RXN-7771}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-7078
- smiles:
- C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O
- common name:
- GDP-β-L-gulose
- inchi key:
- InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L
- molecular weight:
- 603.329
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O" cannot be used as a page name in this wiki.
