Difference between revisions of "CPD-696"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-676 CPD-676] == * smiles: ** C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1) * inchi key: ** InChIKey=QAI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5)))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 24-methylenecycloartanol |
+ | * inchi key: | ||
+ | ** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 440.751 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 24(28)-methylenecycloartanol |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-4021]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21157981 21157981] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830] |
− | + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}} | |
− | + | {{#set: common name=24-methylenecycloartanol}} | |
− | + | {{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}} | |
− | + | {{#set: molecular weight=440.751 }} | |
− | + | {{#set: common name=24(28)-methylenecycloartanol}} | |
− | {{#set: smiles=C | + | {{#set: produced by=RXN-4021}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-696
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
- common name:
- 24-methylenecycloartanol
- inchi key:
- InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
- molecular weight:
- 440.751
- Synonym(s):
- 24(28)-methylenecycloartanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.