Difference between revisions of "Charged-GLY-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] == * smiles: ** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O) * inchi key: ** InChIKe...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLY-tRNAs Charged-GLY-tRNAs] == * common name: ** a glycyl-[tRNAgly] * Synonym(s): ==...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLY-tRNAs Charged-GLY-tRNAs] ==
* smiles:
+
** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)
+
* inchi key:
+
** InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N
+
 
* common name:
 
* common name:
** (+)-(1R,2R)-1,2-diphenylethane-1,2-diol
+
** a glycyl-[tRNAgly]
* molecular weight:
+
** 214.263   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GLYCINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[3.3.2.9-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a glycyl-[tRNAgly]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=853019 853019]
+
{{#set: produced by=GLYCINE--TRNA-LIGASE-RXN}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.745456.html 745456]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50014 50014]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C16015 C16015]
+
* HMDB : HMDB12111
+
{{#set: smiles=C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)}}
+
{{#set: inchi key=InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N}}
+
{{#set: common name=(+)-(1R,2R)-1,2-diphenylethane-1,2-diol}}
+
{{#set: molecular weight=214.263    }}
+
{{#set: reversible reaction associated=3.3.2.9-RXN}}
+

Latest revision as of 20:15, 21 March 2018

Metabolite Charged-GLY-tRNAs

  • common name:
    • a glycyl-[tRNAgly]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a glycyl-[tRNAgly" cannot be used as a page name in this wiki.