Difference between revisions of "Tiso gene 8353"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N...")
 
(Created page with "Category:Gene == Gene Tiso_gene_8353 == * right end position: ** 6959 * transcription direction: ** NEGATIVE * left end position: ** 4577 * centisome position: ** 44.35937...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] ==
+
== Gene Tiso_gene_8353 ==
−
* smiles:
+
* right end position:
−
** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))
+
** 6959
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** folate
+
** 4577
−
* molecular weight:
+
* centisome position:
−
** 439.387    
+
** 44.35937    
 
* Synonym(s):
 
* Synonym(s):
−
** folic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[3.4.17.11-RXN]]
+
* Reaction: [[LYSOPHOSPHOLIPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15035]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6959}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549092 1549092]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=4577}}
−
** [http://www.chemspider.com/Chemical-Structure.1266060.html 1266060]
+
{{#set: centisome position=44.35937   }}
−
* CHEBI:
+
{{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62501 62501]
+
{{#set: pathway associated=PWY-7409}}
−
* HMDB : HMDB00121
+
−
{{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))}}
+
−
{{#set: inchi key=InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-L}}
+
−
{{#set: common name=folate}}
+
−
{{#set: molecular weight=439.387   }}
+
−
{{#set: common name=folic acid}}
+
−
{{#set: consumed by=3.4.17.11-RXN}}
+

Latest revision as of 19:06, 21 March 2018

Gene Tiso_gene_8353

  • right end position:
    • 6959
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 4577
  • centisome position:
    • 44.35937
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8353&oldid=39541"