Difference between revisions of "O-phospho-L-seryl-tRNASecs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-phospho-L-seryl-tRNASecs O-phospho-L-seryl-tRNASecs] == * common name: ** an O-phospho-L-sery...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-phospho-L-seryl-tRNASecs O-phospho-L-seryl-tRNASecs] ==
−
* smiles:
+
−
** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C
+
−
* inchi key:
+
−
** InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N
+
 
* common name:
 
* common name:
−
** zeinoxanthin
+
** an O-phospho-L-seryl-[tRNASec]
−
* molecular weight:
+
−
** 552.882   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β,ε-carotene-3-ol
+
** an O-phosphoseryl-[tRNAsec]
 +
** an O-phosphoseryl-tRNA[Ser]Sec
 +
** an O-phosphoseryl-[tRNA(Sec)]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-5962]]
+
* [[RXN-10039]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-5961]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-10038]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an O-phospho-L-seryl-[tRNASec]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10311902 10311902]
+
{{#set: common name=an O-phosphoseryl-[tRNAsec]|an O-phosphoseryl-tRNA[Ser]Sec|an O-phosphoseryl-[tRNA(Sec)]}}
−
* CHEMSPIDER:
+
{{#set: consumed by=RXN-10039}}
−
** [http://www.chemspider.com/Chemical-Structure.8487368.html 8487368]
+
{{#set: reversible reaction associated=RXN-10038}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65244 65244]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C08590 C08590]
+
−
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C}}
+
−
{{#set: inchi key=InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N}}
+
−
{{#set: common name=zeinoxanthin}}
+
−
{{#set: molecular weight=552.882    }}
+
−
{{#set: common name=β,ε-carotene-3-ol}}
+
−
{{#set: consumed by=RXN-5962}}
+
−
{{#set: produced by=RXN-5961}}
+

Latest revision as of 20:15, 21 March 2018

Metabolite O-phospho-L-seryl-tRNASecs

  • common name:
    • an O-phospho-L-seryl-[tRNASec]
  • Synonym(s):
    • an O-phosphoseryl-[tRNAsec]
    • an O-phosphoseryl-tRNA[Ser]Sec
    • an O-phosphoseryl-[tRNA(Sec)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an O-phospho-L-seryl-[tRNASec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-[tRNAsec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-tRNA[Ser]Sec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-[tRNA(Sec)" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=O-phospho-L-seryl-tRNASecs&oldid=47159"