Difference between revisions of "Tiso gene 6012"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * inchi key: ** InChIKey=HOB...") |
(Created page with "Category:Gene == Gene Tiso_gene_6012 == * right end position: ** 12566 * transcription direction: ** POSITIVE * left end position: ** 10333 * centisome position: ** 81.548...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6012 == |
− | * | + | * right end position: |
− | ** | + | ** 12566 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 10333 |
− | * | + | * centisome position: |
− | ** | + | ** 81.548416 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.6.3.50-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[ATPASE-RXN]] |
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Reaction: [[ATPSYN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=12566}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=10333}} | |
− | + | {{#set: centisome position=81.548416 }} | |
− | + | {{#set: reaction associated=3.6.3.50-RXN|ATPASE-RXN|ATPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:15, 21 March 2018
Gene Tiso_gene_6012
- right end position:
- 12566
- transcription direction:
- POSITIVE
- left end position:
- 10333
- centisome position:
- 81.548416
- Synonym(s):
Reactions associated
- Reaction: 3.6.3.50-RXN
- Source: orthology-esiliculosus
- Reaction: ATPASE-RXN
- Source: orthology-athaliana
- Reaction: ATPSYN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation