Difference between revisions of "Trans-D2-cis-D15-gheddoyl-ACPs"

Latest revision as of 20:15, 21 March 2018

"a trans-delta2-cis-delta15-C34:2-[acp" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-D15-gheddoyl-ACPs trans-D2-cis-D15-gheddoyl-ACPs] ==
-* smiles:
-** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)
-* inchi key:
-** InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L
 * common name:
-** mycophenolic acid phenolic glucuronide
+** a trans-delta2-cis-delta15-C34:2-[acp]
-* molecular weight:
-** 494.451
 * Synonym(s):
 == Reaction(s) known to consume the compound ==
+* [[RXN1G-396]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13608]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a trans-delta2-cis-delta15-C34:2-[acp]}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657160 90657160]
+{{#set: consumed by=RXN1G-396}}
-{{#set: smiles=CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)}}
-{{#set: inchi key=InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L}}
-{{#set: common name=mycophenolic acid phenolic glucuronide}}
-{{#set: molecular weight=494.451    }}
-{{#set: produced by=RXN-13608}}