Difference between revisions of "Tiso gene 20581"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] == * smiles: ** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Gene == Gene Tiso_gene_20581 == * right end position: ** 936 * transcription direction: ** POSITIVE * left end position: ** 815 * centisome position: ** 78.13998...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] ==
+
== Gene Tiso_gene_20581 ==
* smiles:
+
* right end position:
** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 936
* inchi key:
+
* transcription direction:
** InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J
+
** POSITIVE
* common name:
+
* left end position:
** (2E,9Z)-octadecenoyl-CoA
+
** 815
* molecular weight:
+
* centisome position:
** 1025.937    
+
** 78.13998    
 
* Synonym(s):
 
* Synonym(s):
** 18:2-Δ2,Δ9-CoA
 
** 2-trans,9-cis-octadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
* [[RXN-17775]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=936}}
{{#set: inchi key=InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J}}
+
{{#set: transcription direction=POSITIVE}}
{{#set: common name=(2E,9Z)-octadecenoyl-CoA}}
+
{{#set: left end position=815}}
{{#set: molecular weight=1025.937   }}
+
{{#set: centisome position=78.13998   }}
{{#set: common name=18:2-Δ2,Δ9-CoA|2-trans,9-cis-octadecenoyl-CoA}}
+
{{#set: reaction associated=ATPASE-RXN}}
{{#set: produced by=RXN-17775}}
+

Latest revision as of 20:15, 21 March 2018

Gene Tiso_gene_20581

  • right end position:
    • 936
  • transcription direction:
    • POSITIVE
  • left end position:
    • 815
  • centisome position:
    • 78.13998
  • Synonym(s):

Reactions associated

Pathways associated

External links