Difference between revisions of "MANNITOL-1P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=F- F-] == * smiles: ** [F-] * inchi key: ** InChIKey=KRHYYFGTRYWZRS-UHFFFAOYSA-M * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * common name: *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** D-mannitol 1-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 260.137 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** mannitol-1-P |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[MANNITOL-1-PHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[MANNPDEHYDROG-RXN]] |
== External links == | == External links == | ||
| + | * CAS : 15806-48-1 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615341 23615341] |
| + | * HMDB : HMDB01530 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00644 C00644] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.19951338.html 19951338] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61381 61381] |
| − | * | + | * BIGG : mnl1p |
| − | + | {{#set: smiles=C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O}} | |
| − | + | {{#set: common name=D-mannitol 1-phosphate}} | |
| − | {{#set: smiles=[ | + | {{#set: inchi key=InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L}} |
| − | {{#set: | + | {{#set: molecular weight=260.137 }} |
| − | {{#set: | + | {{#set: common name=mannitol-1-P}} |
| − | {{#set: molecular weight= | + | {{#set: consumed by=MANNITOL-1-PHOSPHATASE-RXN}} |
| − | {{#set: common name= | + | {{#set: reversible reaction associated=MANNPDEHYDROG-RXN}} |
| − | {{#set: consumed by= | + | |
| − | + | ||
| − | {{#set: reversible reaction associated= | + | |
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite MANNITOL-1P
- smiles:
- C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O
- common name:
- D-mannitol 1-phosphate
- inchi key:
- InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L
- molecular weight:
- 260.137
- Synonym(s):
- mannitol-1-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 15806-48-1
- PUBCHEM:
- HMDB : HMDB01530
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : mnl1p
"C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O" cannot be used as a page name in this wiki.
