Difference between revisions of "CPD-11402"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine-38-40 tRNA-uridine-38-40] == * common name: ** a uridine38-40 in tRNA * Synonym(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == |
+ | * smiles: | ||
+ | ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3))) | ||
* common name: | * common name: | ||
− | ** | + | ** 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide |
+ | * inchi key: | ||
+ | ** InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M | ||
+ | * molecular weight: | ||
+ | ** 826.095 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3,5,3'-triiodothyronine acyl β-D-glucuronide |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10609]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659330 90659330] |
− | {{#set: | + | {{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))}} |
+ | {{#set: common name=3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide}} | ||
+ | {{#set: inchi key=InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M}} | ||
+ | {{#set: molecular weight=826.095 }} | ||
+ | {{#set: common name=3,5,3'-triiodothyronine acyl β-D-glucuronide}} | ||
+ | {{#set: produced by=RXN-10609}} |
Latest revision as of 21:15, 21 March 2018
Contents
Metabolite CPD-11402
- smiles:
- C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
- common name:
- 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
- inchi key:
- InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
- molecular weight:
- 826.095
- Synonym(s):
- 3,5,3'-triiodothyronine acyl β-D-glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))" cannot be used as a page name in this wiki.