Difference between revisions of "Tiso gene 1369"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] == * smiles: ** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
(Created page with "Category:Gene == Gene Tiso_gene_1369 == * right end position: ** 23172 * transcription direction: ** POSITIVE * left end position: ** 19332 * centisome position: ** 80.395...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] ==
+
== Gene Tiso_gene_1369 ==
−
* smiles:
+
* right end position:
−
** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
+
** 23172
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** neolinustatin
+
** 19332
−
* molecular weight:
+
* centisome position:
−
** 423.416    
+
** 80.395905    
 
* Synonym(s):
 
* Synonym(s):
−
** butanenitrile
 
−
** [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13603]]
+
* Reaction: [[AIRS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[FGFTm]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[FPGFTm]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[GLYRIBONUCSYN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6121]]
 +
* [[PWY-6122]]
 +
* [[PWY-6277]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=23172}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08336 C08336]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=19332}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7506 7506]
+
{{#set: centisome position=80.395905   }}
−
* PUBCHEM:
+
{{#set: reaction associated=AIRS-RXN|FGFTm|FPGFTm|GLYRIBONUCSYN-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119533 119533]
+
{{#set: pathway associated=PWY-6121|PWY-6122|PWY-6277}}
−
* HMDB : HMDB38482
+
−
{{#set: smiles=CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
+
−
{{#set: inchi key=InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N}}
+
−
{{#set: common name=neolinustatin}}
+
−
{{#set: molecular weight=423.416   }}
+
−
{{#set: common name=butanenitrile|[(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]}}
+
−
{{#set: consumed by=RXN-13603}}
+

Latest revision as of 20:15, 21 March 2018

Gene Tiso_gene_1369

  • right end position:
    • 23172
  • transcription direction:
    • POSITIVE
  • left end position:
    • 19332
  • centisome position:
    • 80.395905
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1369&oldid=47220"