Difference between revisions of "RXN-12625"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12625 RXN-12625] == * direction: ** LEFT-TO-RIGHT * common name: ** N,N'-diacetylchitobiose &be...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12625 RXN-12625] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
+
 
* common name:
 
* common name:
−
** 8-oxo-dGMP
+
** N,N'-diacetylchitobiose β-N-acetylglucosaminidase
−
* molecular weight:
+
** beta-hexosaminidase
−
** 361.207   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.2.1.52 EC-3.2.1.52]
 
* Synonym(s):
 
* Synonym(s):
−
** 8-oxo-7,8-dihydro-2'-dGMP
 
−
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
 
−
** 8-oxo-deoxyguanosine-monophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[CHITOBIOSE]][c] '''+''' 1 [[WATER]][c] '''=>''' 2 [[N-acetyl-D-glucosamine]][c]
−
* [[RXN-14205]]
+
* With common name(s):
 +
** 1 N,N'-diacetylchitobiose[c] '''+''' 1 H2O[c] '''=>''' 2 N-acetyl-D-glucosamine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1129]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_14122]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-7822]], chitin degradation III (Serratia): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7822 PWY-7822]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-6902]], chitin degradation II (Vibrio): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6902 PWY-6902]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173535 46173535]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30674 30674]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63224 63224]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00022 R00022]
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L}}
+
{{#set: common name=N,N'-diacetylchitobiose β-N-acetylglucosaminidase}}
−
{{#set: common name=8-oxo-dGMP}}
+
{{#set: common name=beta-hexosaminidase}}
−
{{#set: molecular weight=361.207    }}
+
{{#set: ec number=EC-3.2.1.52}}
−
{{#set: common name=8-oxo-7,8-dihydro-2'-dGMP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate|8-oxo-deoxyguanosine-monophosphate}}
+
{{#set: gene associated=Tiso_gene_1129|Tiso_gene_14122}}
−
{{#set: reversible reaction associated=RXN-14205}}
+
{{#set: in pathway=PWY-7822|PWY-6902}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:15, 21 March 2018

Reaction RXN-12625

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • N,N'-diacetylchitobiose β-N-acetylglucosaminidase
    • beta-hexosaminidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7822, chitin degradation III (Serratia): PWY-7822
    • 2 reactions found over 7 reactions in the full pathway
  • PWY-6902, chitin degradation II (Vibrio): PWY-6902
    • 3 reactions found over 5 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12625&oldid=47224"