Difference between revisions of "Tiso gene 10753"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO * inchi key:...")
(Created page with "Category:Gene == Gene Tiso_gene_10753 == * right end position: ** 5923 * transcription direction: ** POSITIVE * left end position: ** 4433 * centisome position: ** 53.2620...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] ==
+
== Gene Tiso_gene_10753 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO
+
** 5923
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** L-ribulose 5-phosphate
+
** 4433
−
* molecular weight:
+
* centisome position:
−
** 228.095    
+
** 53.262043    
 
* Synonym(s):
 
* Synonym(s):
−
** L-ribulose-5-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.26.3-RXN]]
−
* [[RXN0-5116]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 2922-69-2
+
{{#set: right end position=5923}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145006 21145006]
+
{{#set: left end position=4433}}
−
* LIGAND-CPD:
+
{{#set: centisome position=53.262043   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01101 C01101]
+
{{#set: reaction associated=3.1.26.3-RXN}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.20015750.html 20015750]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58226 58226]
+
−
* BIGG : ru5p__L
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO}}
+
−
{{#set: inchi key=InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L}}
+
−
{{#set: common name=L-ribulose 5-phosphate}}
+
−
{{#set: molecular weight=228.095   }}
+
−
{{#set: common name=L-ribulose-5-P}}
+
−
{{#set: produced by=RXN0-5116}}
+

Latest revision as of 20:15, 21 March 2018

Gene Tiso_gene_10753

  • right end position:
    • 5923
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4433
  • centisome position:
    • 53.262043
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10753&oldid=47228"