Difference between revisions of "CPD1F-137"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] == |
* smiles: | * smiles: | ||
− | ** | + | ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** gibberellin A4 |
+ | * inchi key: | ||
+ | ** InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 331.388 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GA4 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-6550]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN1F-165]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
+ | * LIPID_MAPS : LMPR0104170021 | ||
+ | * DRUGBANK : DB07815 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245706 25245706] |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11864 C11864] |
− | {{#set: | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32902 32902] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC32902 |
− | {{#set: consumed by= | + | {{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}} |
− | {{#set: | + | {{#set: common name=gibberellin A4}} |
+ | {{#set: inchi key=InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M}} | ||
+ | {{#set: molecular weight=331.388 }} | ||
+ | {{#set: common name=GA4}} | ||
+ | {{#set: consumed by=RXN-6550}} | ||
+ | {{#set: produced by=RXN1F-165}} |
Latest revision as of 21:15, 21 March 2018
Contents
Metabolite CPD1F-137
- smiles:
- C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
- common name:
- gibberellin A4
- inchi key:
- InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M
- molecular weight:
- 331.388
- Synonym(s):
- GA4
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPR0104170021
- DRUGBANK : DB07815
- PUBCHEM:
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC32902
"C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.