Difference between revisions of "CPD-4568"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurases L-Cysteine-Desulfurases] == * common name: ** an [L-cysteine desulfuras...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurases L-Cysteine-Desulfurases] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
 +
* smiles:
 +
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
 
* common name:
 
* common name:
** an [L-cysteine desulfurase]
+
** 14-hydroxylanosterol
 +
* inchi key:
 +
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
 +
* molecular weight:
 +
** 442.724   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15881]]
+
* [[RXN66-304]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14388]]
+
* [[RXN66-303]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an [L-cysteine desulfurase]}}
+
* PUBCHEM:
{{#set: consumed by=RXN-15881}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
{{#set: produced by=RXN-14388}}
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
 +
{{#set: common name=14-hydroxylanosterol}}
 +
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
 +
{{#set: molecular weight=442.724    }}
 +
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: consumed by=RXN66-304}}
 +
{{#set: produced by=RXN66-303}}

Latest revision as of 20:15, 21 March 2018

Metabolite CPD-4568

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • common name:
    • 14-hydroxylanosterol
  • inchi key:
    • InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
  • molecular weight:
    • 442.724
  • Synonym(s):
    • 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.