Difference between revisions of "S-1-PHENYLETHANOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1027 CPD0-1027] == * common name: ** a debranched α-limit dextrin * Synonym(s): ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] == * smiles: ** CC(O)C1(C=CC=CC=1) * common name: ** (S)-1...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] == |
+ | * smiles: | ||
+ | ** CC(O)C1(C=CC=CC=1) | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-1-phenylethanol |
+ | * inchi key: | ||
+ | ** InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N | ||
+ | * molecular weight: | ||
+ | ** 122.166 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-1302]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443135 443135] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.391409.html 391409] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16346 16346] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11348 C11348] | ||
+ | {{#set: smiles=CC(O)C1(C=CC=CC=1)}} | ||
+ | {{#set: common name=(S)-1-phenylethanol}} | ||
+ | {{#set: inchi key=InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N}} | ||
+ | {{#set: molecular weight=122.166 }} | ||
+ | {{#set: reversible reaction associated=RXN-1302}} |
Latest revision as of 21:15, 21 March 2018
Contents
Metabolite S-1-PHENYLETHANOL
- smiles:
- CC(O)C1(C=CC=CC=1)
- common name:
- (S)-1-phenylethanol
- inchi key:
- InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N
- molecular weight:
- 122.166
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links