Difference between revisions of "S-Substituted-L-Cysteines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYLGLYCINE GLYCYLGLYCINE] == * smiles: ** C([N+])C(=O)NCC([O-])=O * inchi key: ** InChIKey=Y...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-Substituted-L-Cysteines S-Substituted-L-Cysteines] == * common name: ** an L-cysteine-S-conju...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYLGLYCINE GLYCYLGLYCINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-Substituted-L-Cysteines S-Substituted-L-Cysteines] ==
* smiles:
+
** C([N+])C(=O)NCC([O-])=O
+
* inchi key:
+
** InChIKey=YMAWOPBAYDPSLA-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** glycyl-glycine
+
** an L-cysteine-S-conjugate
* molecular weight:
+
** 132.119   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a cysteine-S-conjugate
 +
** an S-substituted-L-cysteine
 +
** an L-cysteine conjugate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18092]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-6642]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-13684]]
 
== External links  ==
 
== External links  ==
* CAS : 556-50-3
+
{{#set: common name=an L-cysteine-S-conjugate}}
* PUBCHEM:
+
{{#set: common name=a cysteine-S-conjugate|an S-substituted-L-cysteine|an L-cysteine conjugate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1548897 1548897]
+
{{#set: produced by=RXN-6642}}
* HMDB : HMDB11733
+
{{#set: reversible reaction associated=RXN-13684}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02037 C02037]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=356445 356445]
+
* METABOLIGHTS : MTBLC356445
+
{{#set: smiles=C([N+])C(=O)NCC([O-])=O}}
+
{{#set: inchi key=InChIKey=YMAWOPBAYDPSLA-UHFFFAOYSA-N}}
+
{{#set: common name=glycyl-glycine}}
+
{{#set: molecular weight=132.119    }}
+
{{#set: consumed by=RXN-18092}}
+

Latest revision as of 20:15, 21 March 2018

Metabolite S-Substituted-L-Cysteines

  • common name:
    • an L-cysteine-S-conjugate
  • Synonym(s):
    • a cysteine-S-conjugate
    • an S-substituted-L-cysteine
    • an L-cysteine conjugate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links