Difference between revisions of "CPD-15895"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5AminoMe-2-ThioUrdines tRNA-Containing-5AminoMe-2-ThioUrdines] == * common name...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * smiles: ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O * common name: ** al...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5AminoMe-2-ThioUrdines tRNA-Containing-5AminoMe-2-ThioUrdines] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] ==
 +
* smiles:
 +
** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
 
* common name:
 
* common name:
** a 5-aminomethyl-2-thiouridine in tRNA
+
** aldehydo-D-ribose 5-phosphate
 +
* inchi key:
 +
** InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
** a tRNA containing 5-aminomethyl-2-thiouridine
+
** keto-D-ribose 5-phosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5144]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15346]]
 +
* [[RXN-14997]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a 5-aminomethyl-2-thiouridine in tRNA}}
+
* PUBCHEM:
{{#set: common name=a tRNA containing 5-aminomethyl-2-thiouridine}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21115541 21115541]
{{#set: consumed by=RXN0-5144}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58273 58273]
 +
{{#set: smiles=[CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O}}
 +
{{#set: common name=aldehydo-D-ribose 5-phosphate}}
 +
{{#set: inchi key=InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L}}
 +
{{#set: molecular weight=228.095    }}
 +
{{#set: common name=keto-D-ribose 5-phosphate}}
 +
{{#set: produced by=RXN-15346|RXN-14997}}

Latest revision as of 20:15, 21 March 2018

Metabolite CPD-15895

  • smiles:
    • [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
  • common name:
    • aldehydo-D-ribose 5-phosphate
  • inchi key:
    • InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):
    • keto-D-ribose 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.