Difference between revisions of "RXN-10706"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == * smiles: ** CC(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10706 RXN-10706] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10706 RXN-10706] ==
−
* smiles:
+
* direction:
−
** CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M
+
 
* common name:
 
* common name:
−
** N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
+
** acyl-coenzyme_a_oxidase
−
* molecular weight:
+
* ec number:
−
** 362.42   
+
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
−
** ACV
 
−
** L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine
 
−
** δ(L-2-aminoadipyl)-L-cysteinyl-D-valine
 
−
** N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[1.21.3.1-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-11521]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-11522]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 OPC6-CoA[c] '''+''' 1 oxygen[c] '''=>''' 1 OPC6-trans-2-enoyl-CoA[c] '''+''' 1 hydrogen peroxide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
 +
** '''15''' reactions found over '''19''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820470 91820470]
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.3.6}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58572 58572]
+
{{#set: gene associated=Tiso_gene_18566}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-735}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05556 C05556]
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}}
+
−
{{#set: molecular weight=362.42    }}
+
−
{{#set: common name=ACV|L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine|δ(L-2-aminoadipyl)-L-cysteinyl-D-valine|N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}}
+
−
{{#set: consumed by=1.21.3.1-RXN}}
+

Latest revision as of 20:15, 21 March 2018

Reaction RXN-10706

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-735, jasmonic acid biosynthesis: PWY-735
    • 15 reactions found over 19 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10706&oldid=47277"