Difference between revisions of "N-terminal-L-alanine-sulfenate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * smiles: ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) * inchi key...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-alanine-sulfenate N-terminal-L-alanine-sulfenate] == * common name: ** an N-termin...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-alanine-sulfenate N-terminal-L-alanine-sulfenate] ==
−
* smiles:
+
−
** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)
+
−
* inchi key:
+
−
** InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M
+
 
* common name:
 
* common name:
−
** hypoglycin B
+
** an N-terminal 3-sulfeno-L-alanyl-[protein]
−
* molecular weight:
+
−
** 269.277   
+
 
* Synonym(s):
 
* Synonym(s):
−
** hypoglycine B
 
−
** L-gamma-glutamyl-L-hypoglycin
 
−
** γ-glutamyl-β-(methylenecyclopropyl)-alanine
 
−
** (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17882]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-9157]]
+
* [[RXN-17881]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an N-terminal 3-sulfeno-L-alanyl-[protein]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658135 90658135]
+
{{#set: consumed by=RXN-17882}}
−
* Wikipedia : Hypoglycin_B
+
{{#set: produced by=RXN-17881}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C08280 C08280]
+
−
* HMDB : HMDB29428
+
−
{{#set: smiles=C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)}}
+
−
{{#set: inchi key=InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M}}
+
−
{{#set: common name=hypoglycin B}}
+
−
{{#set: molecular weight=269.277    }}
+
−
{{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}}
+
−
{{#set: produced by=RXN-9157}}
+

Latest revision as of 20:15, 21 March 2018

Metabolite N-terminal-L-alanine-sulfenate

  • common name:
    • an N-terminal 3-sulfeno-L-alanyl-[protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal 3-sulfeno-L-alanyl-[protein" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-terminal-L-alanine-sulfenate&oldid=47279"