Difference between revisions of "GTPA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-717 CPD-717] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTPA GTPA] == * direction: ** LEFT-TO-RIGHT * common name: ** GTP-apyrase * Synonym(s): == Reactio...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-717 CPD-717] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTPA GTPA] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=URNVSZVQLKHKDE-WAFXAADMSA-N
+
 
* common name:
 
* common name:
−
** 3-dehydro-6-deoxoteasterone
+
** GTP-apyrase
−
* molecular weight:
+
−
** 432.685   
+
 
* Synonym(s):
 
* Synonym(s):
−
** dehydro-deoxoteasterone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11535]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[GTP]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[GDP]][c] '''+''' 1.0 [[PROTON]][c]
−
* [[RXN-775]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 H2O[c] '''+''' 1.0 GTP[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 GDP[c] '''+''' 1.0 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST01030125
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=GTP-apyrase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061345 16061345]
+
{{#set: gene associated=Tiso_gene_12899}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20710 20710]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15800 C15800]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=URNVSZVQLKHKDE-WAFXAADMSA-N}}
+
−
{{#set: common name=3-dehydro-6-deoxoteasterone}}
+
−
{{#set: molecular weight=432.685    }}
+
−
{{#set: common name=dehydro-deoxoteasterone}}
+
−
{{#set: consumed by=RXN-11535}}
+
−
{{#set: produced by=RXN-775}}
+

Latest revision as of 20:16, 21 March 2018

Reaction GTPA

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • GTP-apyrase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 GTP[c] => 1.0 phosphate[c] + 1.0 GDP[c] + 1.0 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GTPA&oldid=47295"