Difference between revisions of "T2-DECENOYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alpha-D-Galactosides Alpha-D-Galactosides] == * common name: ** an α-D-galactoside * Syno...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-DECENOYL-COA T2-DECENOYL-COA] == * smiles: ** CCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-DECENOYL-COA T2-DECENOYL-COA] == |
+ | * smiles: | ||
+ | ** CCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
* common name: | * common name: | ||
− | ** | + | ** trans-dec-2-enoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=MGNBGCRQQFMNBM-YJHHLLFWSA-J | ||
+ | * molecular weight: | ||
+ | ** 915.738 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2E-decenoyl-CoA | ||
+ | ** 2-trans-decenoyl-CoA | ||
+ | ** trans-Δ2-decenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13616]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-13615]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * BIGG : dc2coa |
− | {{#set: consumed by=RXN- | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50909850 50909850] | ||
+ | * HMDB : HMDB03948 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05275 C05275] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61406 61406] | ||
+ | * METABOLIGHTS : MTBLC61406 | ||
+ | {{#set: smiles=CCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: common name=trans-dec-2-enoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=MGNBGCRQQFMNBM-YJHHLLFWSA-J}} | ||
+ | {{#set: molecular weight=915.738 }} | ||
+ | {{#set: common name=2E-decenoyl-CoA|2-trans-decenoyl-CoA|trans-Δ2-decenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-13616}} | ||
+ | {{#set: produced by=RXN-13615}} |
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite T2-DECENOYL-COA
- smiles:
- CCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- trans-dec-2-enoyl-CoA
- inchi key:
- InChIKey=MGNBGCRQQFMNBM-YJHHLLFWSA-J
- molecular weight:
- 915.738
- Synonym(s):
- 2E-decenoyl-CoA
- 2-trans-decenoyl-CoA
- trans-Δ2-decenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : dc2coa
- PUBCHEM:
- HMDB : HMDB03948
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC61406
"CCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.