Difference between revisions of "Tiso gene 6657"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == * smiles: ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2)) * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_6657 == * right end position: ** 3029 * transcription direction: ** POSITIVE * left end position: ** 42 * centisome position: ** 0.3515527...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6657 == |
− | * | + | * right end position: |
− | ** | + | ** 3029 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 42 |
− | * | + | * centisome position: |
− | ** | + | ** 0.3515527 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GLUTAMIN-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | + | ** Source: [[annotation-experimental_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[GMP-SYN-GLUT-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[GMP-SYN-NH3-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7221]] | ||
+ | * [[GLUTAMINDEG-PWY]] | ||
+ | * [[CITRULBIO-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3029}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=42}} | |
− | + | {{#set: centisome position=0.3515527 }} | |
− | + | {{#set: reaction associated=GLUTAMIN-RXN|GMP-SYN-GLUT-RXN|GMP-SYN-NH3-RXN}} | |
− | + | {{#set: pathway associated=PWY-7221|GLUTAMINDEG-PWY|CITRULBIO-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 20:16, 21 March 2018
Gene Tiso_gene_6657
- right end position:
- 3029
- transcription direction:
- POSITIVE
- left end position:
- 42
- centisome position:
- 0.3515527
- Synonym(s):
Reactions associated
- Reaction: GLUTAMIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: GMP-SYN-GLUT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: GMP-SYN-NH3-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation