Difference between revisions of "Tiso gene 6657"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == * smiles: ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2)) * inchi...")
(Created page with "Category:Gene == Gene Tiso_gene_6657 == * right end position: ** 3029 * transcription direction: ** POSITIVE * left end position: ** 42 * centisome position: ** 0.3515527...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] ==
+
== Gene Tiso_gene_6657 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2))
+
** 3029
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NOTGFIUVDGNKRI-UUOKFMHZSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide
+
** 42
−
* molecular weight:
+
* centisome position:
−
** 336.197    
+
** 0.3515527    
 
* Synonym(s):
 
* Synonym(s):
−
** Z-nucleotide
 
−
** AICAR
 
−
** AICA ribonucleotide
 
−
** 5'-phosphoribosyl-5-amino-4-imidazole carboxamide
 
−
** 5-amino-4-imidazolecarboxamide ribotide
 
−
** 5'-P-ribosyl-5-amino-4-imidazole carboxamide
 
−
** aminoimidazole carboxamide ribonucleotide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[R04560]]
+
* Reaction: [[GLUTAMIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[GLUTAMIDOTRANS-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
−
* [[FPAIF]]
+
*** Assignment: ec-number
−
* [[AICARTRANSFORM-RXN]]
+
** Source: [[orthology-esiliculosus]]
−
* [[AIAL]]
+
* Reaction: [[GMP-SYN-GLUT-RXN]]
−
* [[AICARSYN-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[GMP-SYN-NH3-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-7221]]
 +
* [[GLUTAMINDEG-PWY]]
 +
* [[CITRULBIO-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 3031-94-5
+
{{#set: right end position=3029}}
−
* METABOLIGHTS : MTBLC58475
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: left end position=42}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266657 45266657]
+
{{#set: centisome position=0.3515527   }}
−
* HMDB : HMDB01517
+
{{#set: reaction associated=GLUTAMIN-RXN|GMP-SYN-GLUT-RXN|GMP-SYN-NH3-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7221|GLUTAMINDEG-PWY|CITRULBIO-PWY}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04677 C04677]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58475 58475]
+
−
* BIGG : aicar
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2))}}
+
−
{{#set: inchi key=InChIKey=NOTGFIUVDGNKRI-UUOKFMHZSA-L}}
+
−
{{#set: common name=5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide}}
+
−
{{#set: molecular weight=336.197   }}
+
−
{{#set: common name=Z-nucleotide|AICAR|AICA ribonucleotide|5'-phosphoribosyl-5-amino-4-imidazole carboxamide|5-amino-4-imidazolecarboxamide ribotide|5'-P-ribosyl-5-amino-4-imidazole carboxamide|aminoimidazole carboxamide ribonucleotide}}
+
−
{{#set: consumed by=R04560}}
+
−
{{#set: produced by=GLUTAMIDOTRANS-RXN}}
+
−
{{#set: reversible reaction associated=FPAIF|AICARTRANSFORM-RXN|AIAL|AICARSYN-RXN}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_6657

  • right end position:
    • 3029
  • transcription direction:
    • POSITIVE
  • left end position:
    • 42
  • centisome position:
    • 0.3515527
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6657&oldid=47313"