Difference between revisions of "Tiso gene 16634"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ALPHA-ACETYLORNITHINE N-ALPHA-ACETYLORNITHINE] == * smiles: ** CC(=O)NC(CCC[N+])C(=O)[O-] * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_16634 == * right end position: ** 3998 * transcription direction: ** POSITIVE * left end position: ** 3 * centisome position: ** 7.09219900...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16634 == |
− | * | + | * right end position: |
− | ** | + | ** 3998 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3 |
− | * | + | * centisome position: |
− | ** | + | ** 7.09219900e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[G5DH]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | + | * Reaction: [[G5DHm]] | |
− | == | + | ** Source: [[orthology-creinhardtii]] |
− | * [[ | + | * Reaction: [[GLUTKIN-RXN]] |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[GLUTSEMIALDEHYDROG-RXN]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[PROLINE-MULTI]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[PYRROLINECARBDEHYDROG-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14116]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[ARGASEDEG-PWY]] | ||
+ | * [[PWY-6922]] | ||
+ | * [[PWY-6853]] | ||
+ | * [[PROSYN-PWY]] | ||
+ | * [[PWY-3341]] | ||
+ | * [[PROUT-PWY]] | ||
+ | * [[ARGININE-SYN4-PWY]] | ||
+ | * [[CITRULBIO-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3998}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3}} | |
− | + | {{#set: centisome position=7.09219900e-2}} | |
− | + | {{#set: reaction associated=G5DH|G5DHm|GLUTKIN-RXN|GLUTSEMIALDEHYDROG-RXN|PROLINE-MULTI|PYRROLINECARBDEHYDROG-RXN|RXN-14116}} | |
− | + | {{#set: pathway associated=ARGASEDEG-PWY|PWY-6922|PWY-6853|PROSYN-PWY|PWY-3341|PROUT-PWY|ARGININE-SYN4-PWY|CITRULBIO-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 21:16, 21 March 2018
Gene Tiso_gene_16634
- right end position:
- 3998
- transcription direction:
- POSITIVE
- left end position:
- 3
- centisome position:
- 7.09219900e-2
- Synonym(s):
Reactions associated
- Reaction: G5DH
- Source: orthology-creinhardtii
- Reaction: G5DHm
- Source: orthology-creinhardtii
- Reaction: GLUTKIN-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: GLUTSEMIALDEHYDROG-RXN
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Reaction: PROLINE-MULTI
- Source: orthology-esiliculosus
- Reaction: PYRROLINECARBDEHYDROG-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-14116
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation