Difference between revisions of "CPD-13174"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Initiation-tRNAmet Initiation-tRNAmet] == * common name: ** initiator tRNAmet * Synonym(s): **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * common name:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Initiation-tRNAmet Initiation-tRNAmet] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
 +
* smiles:
 +
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
 
* common name:
 
* common name:
** initiator tRNAmet
+
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
 +
* inchi key:
 +
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 262.262   
 
* Synonym(s):
 
* Synonym(s):
** tRNAfmet
+
** salicyl-HCH
 +
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
 +
** acylsaligenin
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16165]]
+
* [[RXN-12252]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=initiator tRNAmet}}
+
* CAS : 529507-98-0
{{#set: common name=tRNAfmet}}
+
* PUBCHEM:
{{#set: consumed by=RXN-16165}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
 +
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
 +
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
 +
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=262.262    }}
 +
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
 +
{{#set: consumed by=RXN-12252}}

Latest revision as of 21:16, 21 March 2018

Metabolite CPD-13174

  • smiles:
    • C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
  • common name:
    • salicyl-6-hydroxy-2-cyclohexene-on-oyl
  • inchi key:
    • InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
  • molecular weight:
    • 262.262
  • Synonym(s):
    • salicyl-HCH
    • 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
    • acylsaligenin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links