Difference between revisions of "CPD-690"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHFth METHFth] == * direction: ** REVERSIBLE * common name: ** 5,10-Methenyltetrahydrofolate upta...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] == * smiles: ** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] == |
− | * | + | * smiles: |
− | ** | + | ** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11))))) |
* common name: | * common name: | ||
− | ** | + | ** adenosyl-cobyrinate a,c-diamide |
+ | * inchi key: | ||
+ | ** InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H | ||
+ | * molecular weight: | ||
+ | ** 1182.137 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** adenosyl-cobyrinic acid a,c-diamide | ||
+ | ** Adenosyl cobyrinate diamide | ||
+ | ** Adenosylcob(III)yrinic acid a,c-diamide | ||
+ | ** Adenosylcobyrinic acid a,c-diamide | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[R344-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819815 91819815] |
− | {{#set: | + | * HMDB : HMDB01083 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58503 58503] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06506 C06506] |
+ | {{#set: smiles=CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))}} | ||
+ | {{#set: common name=adenosyl-cobyrinate a,c-diamide}} | ||
+ | {{#set: inchi key=InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H}} | ||
+ | {{#set: molecular weight=1182.137 }} | ||
+ | {{#set: common name=adenosyl-cobyrinic acid a,c-diamide|Adenosyl cobyrinate diamide|Adenosylcob(III)yrinic acid a,c-diamide|Adenosylcobyrinic acid a,c-diamide}} | ||
+ | {{#set: produced by=R344-RXN}} |
Latest revision as of 19:31, 21 March 2018
Contents
Metabolite CPD-690
- smiles:
- CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))
- common name:
- adenosyl-cobyrinate a,c-diamide
- inchi key:
- InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H
- molecular weight:
- 1182.137
- Synonym(s):
- adenosyl-cobyrinic acid a,c-diamide
- Adenosyl cobyrinate diamide
- Adenosylcob(III)yrinic acid a,c-diamide
- Adenosylcobyrinic acid a,c-diamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))" cannot be used as a page name in this wiki.