Difference between revisions of "Tiso gene 2667"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
(Created page with "Category:Gene == Gene Tiso_gene_2667 == * Synonym(s): == Reactions associated == * Reaction: 3PGAREARR-RXN ** Source: orthology-synechocystis == Pathways associat...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2667 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3PGAREARR-RXN]] | |
− | == | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-1042]] | ||
+ | * [[P341-PWY]] | ||
+ | * [[PWY-2221]] | ||
+ | * [[GLUCONEO-PWY]] | ||
+ | * [[GLYCOLYSIS]] | ||
+ | * [[PWY-6901]] | ||
+ | * [[PWY-7218]] | ||
+ | * [[P124-PWY]] | ||
+ | * [[PWY-6886]] | ||
+ | * [[PWY-5723]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[PWY-5484]] | ||
+ | * [[PWY-7124]] | ||
+ | * [[PWY-7003]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3PGAREARR-RXN}} | |
− | + | {{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|PWY-7218|P124-PWY|PWY-6886|PWY-5723|PWY-6142|PWY-5484|PWY-7124|PWY-7003}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:16, 21 March 2018
Gene Tiso_gene_2667
- Synonym(s):
Reactions associated
- Reaction: 3PGAREARR-RXN
- Source: orthology-synechocystis
Pathways associated
- PWY-1042
- P341-PWY
- PWY-2221
- GLUCONEO-PWY
- GLYCOLYSIS
- PWY-6901
- PWY-7218
- P124-PWY
- PWY-6886
- PWY-5723
- PWY-6142
- PWY-5484
- PWY-7124
- PWY-7003