Difference between revisions of "CPD-7090"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * smiles: ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O * inchi key: ** InChIKey=U...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-]...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3))) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** delphinidin |
| + | * inchi key: | ||
| + | ** InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 301.232 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** delfinidin |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9723]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7785]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203213 25203213] |
| − | * HMDB : | + | * HMDB : HMDB03074 |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28436 28436] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05908 C05908] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))}} |
| − | {{#set: | + | {{#set: common name=delphinidin}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=301.232 }} |
| − | {{#set: produced by= | + | {{#set: common name=delfinidin}} |
| + | {{#set: consumed by=RXN-9723}} | ||
| + | {{#set: produced by=RXN-7785}} | ||
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite CPD-7090
- smiles:
- C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
- common name:
- delphinidin
- inchi key:
- InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
- molecular weight:
- 301.232
- Synonym(s):
- delfinidin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))" cannot be used as a page name in this wiki.
