Difference between revisions of "RETINAL"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1586 == * left end position: ** 7270 * transcription direction: ** POSITIVE * right end position: ** 8637 * centisome position: ** 31.55108...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == * smiles: ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O * common name: **...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O |
| − | * | + | * common name: |
| − | ** | + | ** all-trans-retinal |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NCYCYZXNIZJOKI-OVSJKPMPSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 284.441 |
* Synonym(s): | * Synonym(s): | ||
| + | ** vitamin A aldehyde | ||
| + | ** retinene | ||
| + | ** axerophthal | ||
| + | ** retinaldehyde | ||
| + | ** retinal | ||
| + | ** all-trans-Vitamin A aldehyde | ||
| + | ** all-trans-retinene | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-13374]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RETINOL-DEHYDROGENASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 116-31-4 |
| − | {{#set: | + | * LIPID_MAPS : LMPR01090002 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=638015 638015] |
| − | {{#set: | + | * HMDB : HMDB01358 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00376 C00376] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.553582.html 553582] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17898 17898] | ||
| + | * METABOLIGHTS : MTBLC17898 | ||
| + | {{#set: smiles=CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O}} | ||
| + | {{#set: common name=all-trans-retinal}} | ||
| + | {{#set: inchi key=InChIKey=NCYCYZXNIZJOKI-OVSJKPMPSA-N}} | ||
| + | {{#set: molecular weight=284.441 }} | ||
| + | {{#set: common name=vitamin A aldehyde|retinene|axerophthal|retinaldehyde|retinal|all-trans-Vitamin A aldehyde|all-trans-retinene}} | ||
| + | {{#set: produced by=RXN-13374}} | ||
| + | {{#set: reversible reaction associated=RETINOL-DEHYDROGENASE-RXN}} | ||
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite RETINAL
- smiles:
- CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O
- common name:
- all-trans-retinal
- inchi key:
- InChIKey=NCYCYZXNIZJOKI-OVSJKPMPSA-N
- molecular weight:
- 284.441
- Synonym(s):
- vitamin A aldehyde
- retinene
- axerophthal
- retinaldehyde
- retinal
- all-trans-Vitamin A aldehyde
- all-trans-retinene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 116-31-4
- LIPID_MAPS : LMPR01090002
- PUBCHEM:
- HMDB : HMDB01358
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC17898
"CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O" cannot be used as a page name in this wiki.
