Difference between revisions of "CPD-13713"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_587 == * left end position: ** 5982 * transcription direction: ** NEGATIVE * right end position: ** 9733 * centisome position: ** 19.189068...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_587 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
−
* left end position:
+
* smiles:
−
** 5982
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** adenosine 5'-phosphoselenate
−
* right end position:
+
* inchi key:
−
** 9733
+
** InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M
−
* centisome position:
+
* molecular weight:
−
** 19.189068    
+
** 473.174    
 
* Synonym(s):
 
* Synonym(s):
 +
** adenylyl-selenate
 +
** APSe
 +
** adenosine phosphoselenate
 +
** adenylylselenate
 +
** adenosine-5'-phosphoselenate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN0-2161]]
+
== Reaction(s) known to produce the compound ==
−
** experimental_annotation
+
* [[RXN-12720]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[SERINE--TRNA-LIGASE-RXN]]
+
−
** experimental_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[TRNA-CHARGING-PWY]]
+
−
* [[PWY0-901]]
+
−
* [[PWY-6281]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=5982}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723]
−
{{#set: right end position=9733}}
+
* HMDB : HMDB04112
−
{{#set: centisome position=19.189068   }}
+
* CHEBI:
−
{{#set: reaction associated=RXN0-2161|SERINE--TRNA-LIGASE-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485]
−
{{#set: pathway associated=TRNA-CHARGING-PWY|PWY0-901|PWY-6281}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686]
 +
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O}}
 +
{{#set: common name=adenosine 5'-phosphoselenate}}
 +
{{#set: inchi key=InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M}}
 +
{{#set: molecular weight=473.174   }}
 +
{{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}}
 +
{{#set: produced by=RXN-12720}}

Latest revision as of 20:17, 21 March 2018

Metabolite CPD-13713

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O
  • common name:
    • adenosine 5'-phosphoselenate
  • inchi key:
    • InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M
  • molecular weight:
    • 473.174
  • Synonym(s):
    • adenylyl-selenate
    • APSe
    • adenosine phosphoselenate
    • adenylylselenate
    • adenosine-5'-phosphoselenate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13713&oldid=47445"