Difference between revisions of "CPD-10813"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE-NUCLEOSIDASE-RXN ADENOSINE-NUCLEOSIDASE-RXN] == * direction: ** LEFT-TO-RIGHT * common na...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10813 CPD-10813] == * smiles: ** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10813 CPD-10813] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** 3,3',5'-triiodo-L-thyronine |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N |
+ | * molecular weight: | ||
+ | ** 650.978 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** reverse triiodothyronine | ||
+ | ** rT3 | ||
+ | ** triiodothyronine, reverse | ||
+ | ** 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine | ||
+ | ** O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10604]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123465 44123465] |
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57261 57261] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57261 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07639 C07639] | |
− | {{#set: | + | {{#set: smiles=C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O}} |
− | + | {{#set: common name=3,3',5'-triiodo-L-thyronine}} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N}} |
− | {{#set: | + | {{#set: molecular weight=650.978 }} |
− | {{#set: | + | {{#set: common name=reverse triiodothyronine|rT3|triiodothyronine, reverse|4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine|O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine}} |
+ | {{#set: consumed by=RXN-10604}} |
Latest revision as of 21:17, 21 March 2018
Contents
Metabolite CPD-10813
- smiles:
- C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O
- common name:
- 3,3',5'-triiodo-L-thyronine
- inchi key:
- InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N
- molecular weight:
- 650.978
- Synonym(s):
- reverse triiodothyronine
- rT3
- triiodothyronine, reverse
- 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine
- O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O" cannot be used as a page name in this wiki.