Difference between revisions of "HOMO-I-CIT"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19413 == * left end position: ** 867 * transcription direction: ** POSITIVE * right end position: ** 2300 * centisome position: ** 37.06712...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * smiles: ** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-] * common name: **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == |
− | * | + | * smiles: |
− | ** | + | ** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** (1R,2S)-homoisocitrate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OEJZZCGRGVFWHK-WVZVXSGGSA-K |
− | * | + | * molecular weight: |
− | ** | + | ** 203.128 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (-)-threo-isohomocitrate | ||
+ | ** (-)-1-hydroxy-1,2,4-butanetricarboxylate | ||
+ | ** homo-I-cit | ||
+ | ** 1-hydroxy-1,2,4-butanetricarboxylate | ||
+ | ** 2-hydroxy-3-carboxyadipate | ||
+ | ** homo-iso-citrate | ||
+ | ** 1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid | ||
+ | ** 1-hydroxybutane-1,2,4-tricarboxylate | ||
+ | ** (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate | ||
+ | ** homoisocitrate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[HOMOACONITATE-HYDRATASE-RXN]] | |
− | + | * [[RXN-13722]] | |
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459812 5459812] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4573580.html 4573580] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15404 15404] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05662 C05662] | ||
+ | {{#set: smiles=C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-]}} | ||
+ | {{#set: common name=(1R,2S)-homoisocitrate}} | ||
+ | {{#set: inchi key=InChIKey=OEJZZCGRGVFWHK-WVZVXSGGSA-K}} | ||
+ | {{#set: molecular weight=203.128 }} | ||
+ | {{#set: common name=(-)-threo-isohomocitrate|(-)-1-hydroxy-1,2,4-butanetricarboxylate|homo-I-cit|1-hydroxy-1,2,4-butanetricarboxylate|2-hydroxy-3-carboxyadipate|homo-iso-citrate|1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid|1-hydroxybutane-1,2,4-tricarboxylate|(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate|homoisocitrate}} | ||
+ | {{#set: reversible reaction associated=HOMOACONITATE-HYDRATASE-RXN|RXN-13722}} |
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite HOMO-I-CIT
- smiles:
- C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-]
- common name:
- (1R,2S)-homoisocitrate
- inchi key:
- InChIKey=OEJZZCGRGVFWHK-WVZVXSGGSA-K
- molecular weight:
- 203.128
- Synonym(s):
- (-)-threo-isohomocitrate
- (-)-1-hydroxy-1,2,4-butanetricarboxylate
- homo-I-cit
- 1-hydroxy-1,2,4-butanetricarboxylate
- 2-hydroxy-3-carboxyadipate
- homo-iso-citrate
- 1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid
- 1-hydroxybutane-1,2,4-tricarboxylate
- (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate
- homoisocitrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-" cannot be used as a page name in this wiki.