Difference between revisions of "RXN-10781"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10781 RXN-10781] == * direction: ** LEFT-TO-RIGHT * common name: ** 5-hydroxytryptophol dehydro...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10781 RXN-10781] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(9Z)-octadecenoyl-CoA
+
** 5-hydroxytryptophol dehydrogenase
−
* molecular weight:
+
** polyketide_synthase
−
** 1041.936   
+
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.1 EC-1.1.1.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-18:1-Δ9-CoA
 
−
** 3-oxo-9-cis-octadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17778]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[5-HYDROXYINDOLE_ACETALDEHYDE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[CPD-11671]][c] '''+''' 1 [[NAD]][c]
−
* [[RXN-17777]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 5-hydroxyindole acetaldehyde[c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 5-hydroxytryptophol[c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6562]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7649]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5424]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6563]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5425]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6313]], serotonin degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6313 PWY-6313]
 +
** '''6''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J}}
+
{{#set: common name=5-hydroxytryptophol dehydrogenase}}
−
{{#set: common name=3-oxo-(9Z)-octadecenoyl-CoA}}
+
{{#set: common name=polyketide_synthase}}
−
{{#set: molecular weight=1041.936    }}
+
{{#set: common name=ORF}}
−
{{#set: common name=3-oxo-18:1-Δ9-CoA|3-oxo-9-cis-octadecenoyl-CoA}}
+
{{#set: ec number=EC-1.1.1.1}}
−
{{#set: consumed by=RXN-17778}}
+
{{#set: gene associated=Tiso_gene_6562|Tiso_gene_7649|Tiso_gene_5424|Tiso_gene_6563|Tiso_gene_5425}}
−
{{#set: produced by=RXN-17777}}
+
{{#set: in pathway=PWY-6313}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:31, 21 March 2018

Reaction RXN-10781

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 5-hydroxytryptophol dehydrogenase
    • polyketide_synthase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6313, serotonin degradation: PWY-6313
    • 6 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10781&oldid=42107"