Difference between revisions of "GLYCYL-PEPTIDE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1541 == * left end position: ** 10644 * transcription direction: ** POSITIVE * right end position: ** 15078 * centisome position: ** 45.458...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] == * smiles: ** C(C(NC(C(O)=O)[R])=O)N * common name: ** glycyl-...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(NC(C(O)=O)[R])=O)N |
− | * | + | * common name: |
− | ** | + | ** glycyl-peptide |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[2.3.1.97-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02038 C02038] | |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16462 16462] |
− | {{#set: | + | {{#set: smiles=C(C(NC(C(O)=O)[R])=O)N}} |
− | {{#set: | + | {{#set: common name=glycyl-peptide}} |
+ | {{#set: reversible reaction associated=2.3.1.97-RXN}} |
Latest revision as of 20:31, 21 March 2018
Contents
Metabolite GLYCYL-PEPTIDE
- smiles:
- C(C(NC(C(O)=O)[R])=O)N
- common name:
- glycyl-peptide
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(NC(C(O)=O)[R])=O)N" cannot be used as a page name in this wiki.