Difference between revisions of "DCTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14899 RXN-14899] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphatidylcholine phospho...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14899 RXN-14899] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
 
* common name:
 
* common name:
−
** phosphatidylcholine phospholipase
+
** dCTP
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.1.1 EC-3.1.1]
+
** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
 +
* molecular weight:
 +
** 463.127   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2'-deoxycytidine-5'-triphosphate
 +
** deoxycytidine-triphosphate
 +
** deoxy-CTP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14198]]
−
** 2 [[WATER]][c] '''+''' 1 [[PHOSPHATIDYLCHOLINE]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[L-1-GLYCERO-PHOSPHORYLCHOLINE]][c] '''+''' 2 [[Carboxylates]][c]
+
* [[DCTP-PYROPHOSPHATASE-RXN]]
−
* With common name(s):
+
* [[DCTCP]]
−
** 2 H2O[c] '''+''' 1 a phosphatidylcholine[c] '''=>''' 2 H+[c] '''+''' 1 sn-glycero-3-phosphocholine[c] '''+''' 2 a carboxylate[c]
+
* [[RME255]]
−
 
+
* [[DCTUP]]
−
== Genes associated with this reaction  ==
+
* [[RXN-14216]]
−
Genes have been associated with this reaction based on different elements listed below.
+
== Reaction(s) known to produce the compound ==
−
* [[Tiso_gene_15692]]
+
* [[ATDCD]]
−
** [[pantograph]]-[[esiliculosus]]
+
* [[DCDPKIN-RXN]]
−
* [[Tiso_gene_334]]
+
* [[ATDCDm]]
−
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
−
* [[Tiso_gene_2505]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_20565]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7367]], phosphatidylcholine resynthesis via glycerophosphocholine: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7367 PWY-7367]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 2056-98-6
−
{{#set: common name=phosphatidylcholine phospholipase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-3.1.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665]
−
{{#set: gene associated=Tiso_gene_15692|Tiso_gene_334|Tiso_gene_2505|Tiso_gene_20565}}
+
* HMDB : HMDB00998
−
{{#set: in pathway=PWY-7367}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458]
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481]
 +
* BIGG : dctp
 +
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
 +
{{#set: common name=dCTP}}
 +
{{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}}
 +
{{#set: molecular weight=463.127    }}
 +
{{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}}
 +
{{#set: consumed by=RXN-14198|DCTP-PYROPHOSPHATASE-RXN|DCTCP|RME255|DCTUP|RXN-14216}}
 +
{{#set: produced by=ATDCD|DCDPKIN-RXN|ATDCDm}}

Latest revision as of 20:18, 21 March 2018

Metabolite DCTP

  • smiles:
    • C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
  • common name:
    • dCTP
  • inchi key:
    • InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
  • molecular weight:
    • 463.127
  • Synonym(s):
    • 2'-deoxycytidine-5'-triphosphate
    • deoxycytidine-triphosphate
    • deoxy-CTP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 2056-98-6
  • PUBCHEM:
  • HMDB : HMDB00998
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : dctp
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DCTP&oldid=47591"