Difference between revisions of "GDP-L-GALACTOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9558 RXN-9558] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9558 RXN-9558] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** GDP-β-L-galactose
 +
* inchi key:
 +
** InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L
 +
* molecular weight:
 +
** 603.329   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[cis-vaccen-2-enoyl-ACPs]][c] '''=>''' 1 [[Cis-vaccenoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-7772]]
−
** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a (2-trans-11-cis)-vaccen-2-enoyl-[acp][c] '''=>''' 1 a cis-vaccenoyl-[acp][c] '''+''' 1 NAD+[c]
+
* [[RXN-1882]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10778]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.3.1.9}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200538 25200538]
−
{{#set: gene associated=Tiso_gene_10778}}
+
* CHEBI:
−
{{#set: in pathway=PWY-5973}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61454 61454]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02280 C02280]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O}}
 +
{{#set: common name=GDP-β-L-galactose}}
 +
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L}}
 +
{{#set: molecular weight=603.329    }}
 +
{{#set: reversible reaction associated=RXN-7772|RXN-1882}}

Latest revision as of 20:18, 21 March 2018

Metabolite GDP-L-GALACTOSE

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O
  • common name:
    • GDP-β-L-galactose
  • inchi key:
    • InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L
  • molecular weight:
    • 603.329
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GDP-L-GALACTOSE&oldid=47629"