Difference between revisions of "CPDQT-4"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1914 == * Synonym(s): == Reactions associated == * ATPASE-RXN ** in-silico_annotation ***ec-number == Pathways associated == == Extern...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * common name: ** &b...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_1914 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] ==
 +
* smiles:
 +
** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
 +
* common name:
 +
** β-L-galactose 1-phosphate
 +
* inchi key:
 +
** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
 +
* molecular weight:
 +
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATPASE-RXN]]
+
* [[RXNQT-4142]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=ATPASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926]
 +
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}}
 +
{{#set: common name=β-L-galactose 1-phosphate}}
 +
{{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}}
 +
{{#set: molecular weight=258.121    }}
 +
{{#set: consumed by=RXNQT-4142}}

Latest revision as of 20:18, 21 March 2018

Metabolite CPDQT-4

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
  • common name:
    • β-L-galactose 1-phosphate
  • inchi key:
    • InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
  • molecular weight:
    • 258.121
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)" cannot be used as a page name in this wiki.