Difference between revisions of "CPD-8563"

Latest revision as of 20:18, 21 March 2018

"C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_6012 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] ==
-* left end position:
+* smiles:
-** 10333
+** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]
-* transcription direction:
+* common name:
-** POSITIVE
+** myosin light-chain phosphate
-* right end position:
-** 12566
-* centisome position:
-** 81.548416
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[3.6.3.50-RXN]]
+== Reaction(s) known to produce the compound ==
-** [[pantograph]]-[[esiliculosus]]
+== Reaction(s) of unknown directionality ==
-* [[ATPASE-RXN]]
+* [[2.7.11.18-RXN]]
-** [[pantograph]]-[[athaliana]]
-* [[ATPSYN-RXN]]
-** in-silico_annotation
-***ec-number
-** experimental_annotation
-***ec-number
-** [[pantograph]]-[[esiliculosus]]
-== Pathways associated ==
-* [[PWY-7219]]
 == External links  ==
-{{#set: left end position=10333}}
+* LIGAND-CPD:
-{{#set: transcription direction=POSITIVE}}
+** [http://www.genome.jp/dbget-bin/www_bget?C03875 C03875]
-{{#set: right end position=12566}}
+{{#set: smiles=C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]}}
-{{#set: centisome position=81.548416    }}
+{{#set: common name=myosin light-chain phosphate}}
-{{#set: reaction associated=3.6.3.50-RXN|ATPASE-RXN|ATPSYN-RXN}}
+{{#set: reversible reaction associated=2.7.11.18-RXN}}
-{{#set: pathway associated=PWY-7219}}