Difference between revisions of "CPD-17373"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4272 == * Synonym(s): == Reactions associated == * TRANS-RXN-21 ** pantograph-creinhardtii == Pathways associated == == Extern...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_4272 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] ==
 +
* smiles:
 +
** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
 +
* common name:
 +
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
 +
* inchi key:
 +
** InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
 +
* molecular weight:
 +
** 728.942   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[TRANS-RXN-21]]
+
* [[RXN-16121]]
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
* [[RXN-16118]]
 +
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=TRANS-RXN-21}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819824 91819824]
 +
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O}}
 +
{{#set: common name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}}
 +
{{#set: inchi key=InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L}}
 +
{{#set: molecular weight=728.942    }}
 +
{{#set: consumed by=RXN-16121}}
 +
{{#set: produced by=RXN-16118}}

Latest revision as of 20:18, 21 March 2018

Metabolite CPD-17373

  • smiles:
    • C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
  • common name:
    • 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
  • inchi key:
    • InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
  • molecular weight:
    • 728.942
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate" cannot be used as a page name in this wiki.