Difference between revisions of "CPD-7137"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_19254 == * left end position: ** 392 * transcription direction: ** POSITIVE * right end position: ** 1610 * centisome position: ** 15.80645...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * smiles: ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_19254 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] ==
* left end position:
+
* smiles:
** 392
+
** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
* transcription direction:
+
* common name:
** POSITIVE
+
** pelargonidin-3,5-di-O-β-D-glucoside
* right end position:
+
* inchi key:
** 1610
+
** InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
* centisome position:
+
* molecular weight:
** 15.806452    
+
** 594.525    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PYRROLINECARBREDUCT-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-7828]]
***ec-number
+
== Reaction(s) of unknown directionality ==
* [[RXN66-546]]
+
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-6344]]
+
* [[ARG-PRO-PWY]]
+
* [[PROSYN-PWY]]
+
* [[PWY-4981]]
+
* [[PWY-3341]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=392}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167643 167643]
{{#set: right end position=1610}}
+
* HMDB : HMDB33681
{{#set: centisome position=15.806452    }}
+
* CHEBI:
{{#set: reaction associated=PYRROLINECARBREDUCT-RXN|RXN66-546}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57503 57503]
{{#set: pathway associated=PWY-6344|ARG-PRO-PWY|PROSYN-PWY|PWY-4981|PWY-3341}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C08725 C08725]
 +
{{#set: smiles=C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)}}
 +
{{#set: common name=pelargonidin-3,5-di-O-β-D-glucoside}}
 +
{{#set: inchi key=InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N}}
 +
{{#set: molecular weight=594.525    }}
 +
{{#set: produced by=RXN-7828}}

Latest revision as of 21:19, 21 March 2018

Metabolite CPD-7137

  • smiles:
    • C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
  • common name:
    • pelargonidin-3,5-di-O-β-D-glucoside
  • inchi key:
    • InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
  • molecular weight:
    • 594.525
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)" cannot be used as a page name in this wiki.