Difference between revisions of "UDP-D-GALACTO-14-FURANOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=M5TRPI M5TRPI] == * direction: ** LEFT-TO-RIGHT * common name: ** S-methyl-5-thioribose-1-phosphate...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=M5TRPI M5TRPI] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
 
* common name:
 
* common name:
−
** S-methyl-5-thioribose-1-phosphate isomerase
+
** UDP-α-D-galactofuranose
 +
* inchi key:
 +
** InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L
 +
* molecular weight:
 +
** 564.289   
 
* Synonym(s):
 
* Synonym(s):
 +
** UDP-Galf
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[CPD-444]][c] '''=>''' 1.0 [[CPD-1063]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[GALPMUT-RXN]]
−
** 1.0 S-methyl-5-thio-α-D-ribose 1-phosphate[c] '''=>''' 1.0 5-methylthioribulose 1-phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3805]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_11893]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=S-methyl-5-thioribose-1-phosphate isomerase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244316 25244316]
−
{{#set: gene associated=Tiso_gene_3805|Tiso_gene_11893}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66915 66915]
−
{{#set: reconstruction category=orthology}}
+
* BIGG : udpgalfur
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03733 C03733]
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}}
 +
{{#set: common name=UDP-α-D-galactofuranose}}
 +
{{#set: inchi key=InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L}}
 +
{{#set: molecular weight=564.289    }}
 +
{{#set: common name=UDP-Galf}}
 +
{{#set: reversible reaction associated=GALPMUT-RXN}}

Latest revision as of 20:19, 21 March 2018

Metabolite UDP-D-GALACTO-14-FURANOSE

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
  • common name:
    • UDP-α-D-galactofuranose
  • inchi key:
    • InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L
  • molecular weight:
    • 564.289
  • Synonym(s):
    • UDP-Galf

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=UDP-D-GALACTO-14-FURANOSE&oldid=47826"