Difference between revisions of "CPD-14950"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_13817 == * left end position: ** 4489 * transcription direction: ** POSITIVE * right end position: ** 6006 * centisome position: ** 74.272...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * c...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_13817 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] ==
−
* left end position:
+
* smiles:
−
** 4489
+
** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 3-O-methylkaempferol
−
* right end position:
+
* inchi key:
−
** 6006
+
** InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
−
* centisome position:
+
* molecular weight:
−
** 74.272    
+
** 300.267    
 
* Synonym(s):
 
* Synonym(s):
 +
** kaempferol 3-methyl ether
 +
** 3-Methoxyapigenin
 +
** isokaempferide
 +
** 3-methylkaempferol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-13398]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-13935]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[RXN-7676]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[RXN-7677]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-5068]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4489}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280862 5280862]
−
{{#set: right end position=6006}}
+
* CHEBI:
−
{{#set: centisome position=74.272   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1579 1579]
−
{{#set: reaction associated=RXN-13398|RXN-7676|RXN-7677}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-5068}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05902 C05902]
 +
{{#set: smiles=COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))}}
 +
{{#set: common name=3-O-methylkaempferol}}
 +
{{#set: inchi key=InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=300.267   }}
 +
{{#set: common name=kaempferol 3-methyl ether|3-Methoxyapigenin|isokaempferide|3-methylkaempferol}}
 +
{{#set: produced by=RXN-13935}}

Latest revision as of 20:20, 21 March 2018

Metabolite CPD-14950

  • smiles:
    • COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
  • common name:
    • 3-O-methylkaempferol
  • inchi key:
    • InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
  • molecular weight:
    • 300.267
  • Synonym(s):
    • kaempferol 3-methyl ether
    • 3-Methoxyapigenin
    • isokaempferide
    • 3-methylkaempferol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-14950&oldid=47857"