Difference between revisions of "CPD-14926"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1377 == * left end position: ** 21535 * transcription direction: ** POSITIVE * right end position: ** 22785 * centisome position: ** 89.643...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * common name: ** phyte...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_1377 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] ==
−
* left end position:
+
* smiles:
−
** 21535
+
** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** phytenal
−
* right end position:
+
* inchi key:
−
** 22785
+
** InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
−
* centisome position:
+
* molecular weight:
−
** 89.64326    
+
** 294.52    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2E-phytenal
 +
** 3,7,11,15-tetramethyl-2E-hexadecenal
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GLUTATHIONE-PEROXIDASE-RXN]]
+
* [[RXN66-479]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN66-478]]
−
** experimental_annotation
+
== Reaction(s) of unknown directionality ==
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[DETOX1-PWY-1]]
+
−
* [[PWY-4081]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=21535}}
+
* LIPID_MAPS : LMPR0104010025
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=22785}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9900764 9900764]
−
{{#set: centisome position=89.64326   }}
+
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O}}
−
{{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN}}
+
{{#set: common name=phytenal}}
−
{{#set: pathway associated=DETOX1-PWY-1|PWY-4081}}
+
{{#set: inchi key=InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N}}
 +
{{#set: molecular weight=294.52   }}
 +
{{#set: common name=2E-phytenal|3,7,11,15-tetramethyl-2E-hexadecenal}}
 +
{{#set: consumed by=RXN66-479}}
 +
{{#set: produced by=RXN66-478}}

Latest revision as of 19:31, 21 March 2018

Metabolite CPD-14926

  • smiles:
    • CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
  • common name:
    • phytenal
  • inchi key:
    • InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
  • molecular weight:
    • 294.52
  • Synonym(s):
    • 2E-phytenal
    • 3,7,11,15-tetramethyl-2E-hexadecenal

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMPR0104010025
  • PUBCHEM:
"CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-14926&oldid=42146"