Difference between revisions of "ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-901 RXN0-901] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.17....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == * smiles: ** C([N...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-901 RXN0-901] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C([N+])COP([O-])(=O)OCC(O)CO[R]
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/1.17.1.4 EC-1.17.1.4]
+
** 1-alkyl-sn-glycero-3-phosphoethanolamine
 
* Synonym(s):
 
* Synonym(s):
 +
** 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine
 +
** 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine
 +
** 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[WATER]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[XANTHINE]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[URATE]][c]
+
* [[LPLPS1AGPE180]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 H2O[c] '''+''' 1 NAD+[c] '''+''' 1 xanthine[c] '''<=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 urate[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_11775]]
+
** [[pantograph]]-[[athaliana]]
+
== Pathways  ==
+
* [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497]
+
** '''7''' reactions found over '''24''' reactions in the full pathway
+
* [[SALVADEHYPOX-PWY]], adenosine nucleotides degradation II: [http://metacyc.org/META/NEW-IMAGE?object=SALVADEHYPOX-PWY SALVADEHYPOX-PWY]
+
** '''5''' reactions found over '''5''' reactions in the full pathway
+
* [[P164-PWY]], purine nucleobases degradation I (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=P164-PWY P164-PWY]
+
** '''4''' reactions found over '''17''' reactions in the full pathway
+
* [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596]
+
** '''8''' reactions found over '''8''' reactions in the full pathway
+
* [[PWY-6607]], guanosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6607 PWY-6607]
+
** '''3''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-6606]], guanosine nucleotides degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6606 PWY-6606]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-6999]], theophylline degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6999 PWY-6999]
+
** '''2''' reactions found over '''9''' reactions in the full pathway
+
* [[PWY-6608]], guanosine nucleotides degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6608 PWY-6608]
+
** '''3''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-5695]], urate biosynthesis/inosine 5'-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5695 PWY-5695]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-6538]], caffeine degradation III (bacteria, via demethylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6538 PWY-6538]
+
** '''2''' reactions found over '''7''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-athaliana]]
+
*** Tool: [[pantograph]]
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* LIGAND-CPD:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16669 16669]
+
** [http://www.genome.jp/dbget-bin/www_bget?C04476 C04476]
* LIGAND-RXN:
+
* CHEBI:
** [http://www.genome.jp/dbget-bin/www_bget?R02103 R02103]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18244 18244]
* UNIPROT:
+
{{#set: smiles=C([N+])COP([O-])(=O)OCC(O)CO[R]}}
** [http://www.uniprot.org/uniprot/Q62637 Q62637]
+
{{#set: common name=1-alkyl-sn-glycero-3-phosphoethanolamine}}
** [http://www.uniprot.org/uniprot/P22811 P22811]
+
{{#set: common name=1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine|1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine|1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine}}
** [http://www.uniprot.org/uniprot/Q12553 Q12553]
+
{{#set: produced by=LPLPS1AGPE180}}
** [http://www.uniprot.org/uniprot/P08793 P08793]
+
** [http://www.uniprot.org/uniprot/P10351 P10351]
+
** [http://www.uniprot.org/uniprot/Q7M0I7 Q7M0I7]
+
** [http://www.uniprot.org/uniprot/Q7M0I8 Q7M0I8]
+
** [http://www.uniprot.org/uniprot/Q7M0I9 Q7M0I9]
+
** [http://www.uniprot.org/uniprot/P47990 P47990]
+
** [http://www.uniprot.org/uniprot/P47989 P47989]
+
** [http://www.uniprot.org/uniprot/Q00519 Q00519]
+
{{#set: direction=REVERSIBLE}}
+
{{#set: ec number=EC-1.17.1.4}}
+
{{#set: gene associated=Tiso_gene_11775}}
+
{{#set: in pathway=PWY-5497|SALVADEHYPOX-PWY|P164-PWY|PWY-6596|PWY-6607|PWY-6606|PWY-6999|PWY-6608|PWY-5695|PWY-6538}}
+
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 20:20, 21 March 2018

Metabolite ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE

  • smiles:
    • C([N+])COP([O-])(=O)OCC(O)CO[R]
  • common name:
    • 1-alkyl-sn-glycero-3-phosphoethanolamine
  • Synonym(s):
    • 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine
    • 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine
    • 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([N+])COP([O-])(=O)OCC(O)CO[R" cannot be used as a page name in this wiki.