Difference between revisions of "CPD-16491"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_451 == * left end position: ** 27086 * transcription direction: ** POSITIVE * right end position: ** 29312 * centisome position: ** 81.0642...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == * smiles: ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) * common name: ** 2,6-dia...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == |
− | * | + | * smiles: |
− | ** | + | ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) |
− | * | + | * common name: |
− | ** | + | ** 2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 183.169 |
* Synonym(s): | * Synonym(s): | ||
+ | ** N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[3.2.2.23-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04744 C04744] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28643 28643] |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=127546 127546] | ||
+ | * HMDB : HMDB11657 | ||
+ | {{#set: smiles=CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)}} | ||
+ | {{#set: common name=2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine}} | ||
+ | {{#set: inchi key=InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=183.169 }} | ||
+ | {{#set: common name=N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide}} | ||
+ | {{#set: produced by=3.2.2.23-RXN}} |
Latest revision as of 21:21, 21 March 2018
Contents
Metabolite CPD-16491
- smiles:
- CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)
- common name:
- 2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine
- inchi key:
- InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N
- molecular weight:
- 183.169
- Synonym(s):
- N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)" cannot be used as a page name in this wiki.