Difference between revisions of "CPD-8985"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4992 == * Synonym(s): == Reactions associated == * CYTOCHROME-C-PEROXIDASE-RXN ** in-silico_annotation ***ec-number == Pathways associ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] == * smiles: ** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O) * common name: ** (+)-(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] == |
+ | * smiles: | ||
+ | ** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O) | ||
+ | * common name: | ||
+ | ** (+)-(1R,2R)-1,2-diphenylethane-1,2-diol | ||
+ | * inchi key: | ||
+ | ** InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N | ||
+ | * molecular weight: | ||
+ | ** 214.263 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[3.3.2.9-RXN]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=853019 853019] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.745456.html 745456] | ||
+ | * HMDB : HMDB12111 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50014 50014] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16015 C16015] | ||
+ | {{#set: smiles=C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)}} | ||
+ | {{#set: common name=(+)-(1R,2R)-1,2-diphenylethane-1,2-diol}} | ||
+ | {{#set: inchi key=InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N}} | ||
+ | {{#set: molecular weight=214.263 }} | ||
+ | {{#set: reversible reaction associated=3.3.2.9-RXN}} |
Latest revision as of 21:21, 21 March 2018
Contents
Metabolite CPD-8985
- smiles:
- C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)
- common name:
- (+)-(1R,2R)-1,2-diphenylethane-1,2-diol
- inchi key:
- InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N
- molecular weight:
- 214.263
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links