Difference between revisions of "CPD-19169"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14073 RXN-14073] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14073 RXN-14073] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** ORF
+
** 3-oxo-(9Z)-octadecenoyl-CoA
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/3.1.4.46 EC-3.1.4.46]
+
** InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
 +
* molecular weight:
 +
** 1041.936   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-18:1-Δ9-CoA
 +
** 3-oxo-9-cis-octadecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17778]]
** 1 [[WATER]][c] '''+''' 1 [[GLYCEROPHOSPHOGLYCEROL]][c] '''=>''' 1 [[GLYCEROL-3P]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[GLYCEROL]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17777]]
** 1 H2O[c] '''+''' 1 glycerophosphoglycerol[c] '''=>''' 1 sn-glycerol 3-phosphate[c] '''+''' 1 H+[c] '''+''' 1 glycerol[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_5334]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
* [[Tiso_gene_17232]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29910 29910]
+
{{#set: common name=3-oxo-(9Z)-octadecenoyl-CoA}}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J}}
{{#set: common name=ORF}}
+
{{#set: molecular weight=1041.936    }}
{{#set: ec number=EC-3.1.4.46}}
+
{{#set: common name=3-oxo-18:1-Δ9-CoA|3-oxo-9-cis-octadecenoyl-CoA}}
{{#set: gene associated=Tiso_gene_5334|Tiso_gene_17232}}
+
{{#set: consumed by=RXN-17778}}
{{#set: in pathway=}}
+
{{#set: produced by=RXN-17777}}
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 19:31, 21 March 2018

Metabolite CPD-19169

  • smiles:
    • CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-oxo-(9Z)-octadecenoyl-CoA
  • inchi key:
    • InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
  • molecular weight:
    • 1041.936
  • Synonym(s):
    • 3-oxo-18:1-Δ9-CoA
    • 3-oxo-9-cis-octadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.