Difference between revisions of "CPD-12045"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXKIN-RXN PYRIDOXKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** pyridoxal_kinase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] == * smiles: ** C(O)C1(C(O)C(O)C(O)O1) * common name: ** α-L-arabino...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXKIN-RXN PYRIDOXKIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)C(O)C(O)O1)
 
* common name:
 
* common name:
−
** pyridoxal_kinase
+
** α-L-arabinofuranose
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.1.35 EC-2.7.1.35]
+
** InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N
 +
* molecular weight:
 +
** 150.131   
 
* Synonym(s):
 
* Synonym(s):
 +
** α-L-arabinose
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PYRIDOXAL]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[PYRIDOXAL_PHOSPHATE]][c] '''+''' 1 [[ADP]][c]
+
* [[3.2.1.55-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 pyridoxal[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 pyridoxal 5'-phosphate[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_6106]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
* [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7282]], 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282]
+
−
** '''6''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PLPSAL-PWY]], pyridoxal 5'-phosphate salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PLPSAL-PWY PLPSAL-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* DRUGBANK : DB03142
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10224 10224]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445935 445935]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00174 R00174]
+
* CHEMSPIDER:
−
* UNIPROT:
+
** [http://www.chemspider.com/Chemical-Structure.393416.html 393416]
−
** [http://www.uniprot.org/uniprot/Q7M2L1 Q7M2L1]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P44690 P44690]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28772 28772]
−
** [http://www.uniprot.org/uniprot/P77150 P77150]
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)O1)}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=α-L-arabinofuranose}}
−
{{#set: common name=pyridoxal_kinase}}
+
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N}}
−
{{#set: ec number=EC-2.7.1.35}}
+
{{#set: molecular weight=150.131    }}
−
{{#set: gene associated=Tiso_gene_6106}}
+
{{#set: common name=α-L-arabinose}}
−
{{#set: in pathway=PWY-7204|PWY-7282|PLPSAL-PWY}}
+
{{#set: produced by=3.2.1.55-RXN}}
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=orthology-creinhardtii|orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-12045

  • smiles:
    • C(O)C1(C(O)C(O)C(O)O1)
  • common name:
    • α-L-arabinofuranose
  • inchi key:
    • InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N
  • molecular weight:
    • 150.131
  • Synonym(s):
    • α-L-arabinose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12045&oldid=48057"