Difference between revisions of "CPD-14604"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_19054 == * Synonym(s): == Reactions associated == * PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN ** pantograph-esiliculosus == Pathw...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] == * smiles: ** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_19054 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] ==
 +
* smiles:
 +
** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)
 +
* common name:
 +
** mycophenolic acid phenolic glucuronide
 +
* inchi key:
 +
** InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L
 +
* molecular weight:
 +
** 494.451   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-13608]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657160 90657160]
 +
{{#set: smiles=CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)}}
 +
{{#set: common name=mycophenolic acid phenolic glucuronide}}
 +
{{#set: inchi key=InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L}}
 +
{{#set: molecular weight=494.451    }}
 +
{{#set: produced by=RXN-13608}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-14604

  • smiles:
    • CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)
  • common name:
    • mycophenolic acid phenolic glucuronide
  • inchi key:
    • InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L
  • molecular weight:
    • 494.451
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)" cannot be used as a page name in this wiki.