Difference between revisions of "CPD-14604"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19054 == * Synonym(s): == Reactions associated == * PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN ** pantograph-esiliculosus == Pathw...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] == * smiles: ** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] == |
+ | * smiles: | ||
+ | ** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC) | ||
+ | * common name: | ||
+ | ** mycophenolic acid phenolic glucuronide | ||
+ | * inchi key: | ||
+ | ** InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L | ||
+ | * molecular weight: | ||
+ | ** 494.451 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-13608]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657160 90657160] | ||
+ | {{#set: smiles=CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)}} | ||
+ | {{#set: common name=mycophenolic acid phenolic glucuronide}} | ||
+ | {{#set: inchi key=InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L}} | ||
+ | {{#set: molecular weight=494.451 }} | ||
+ | {{#set: produced by=RXN-13608}} |
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD-14604
- smiles:
- CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)
- common name:
- mycophenolic acid phenolic glucuronide
- inchi key:
- InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L
- molecular weight:
- 494.451
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)" cannot be used as a page name in this wiki.